Organooxygen compounds
Medchemexpress LLC Ganoderenic acid E | 110241-23-1 | 1 MG
Ganoderenic acid E is a lanostane-type triterpene with a purity of 95.0%. It has a molecular weight of 528.63 and a molecular formula of C30H40O8. This compound appears as a white to off-white solid.
- Lanostane-type triterpene
- Purity of 95.0%
- Molecular weight: 528.63
- Molecular formula: C30H40O8
- Appearance: solid
- Color: white to off-white
eMolecules 2162961-71-7 | Medchem Express | BI-2545 | 5mg | 532149168 | HY-124772 | 527.427 | C23H19F6N5O3
Medchem Express | ML148 | 1mg | 721772028 | HY-123548 | 451496-96-1 | MFCD04422127 | 319.408 | C20H21N3O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1446418-48-9 | Medchem Express | Abacavir hydroxyacetate | 5mg | 721771536 | HY-106647 | MFCD27987941 | 344.375 | C16H20N6O3
Ambeed | (4-Ethynylphenyl)methanamine | 100mg | 531647000 | A122710 | 197844-23-8 | MFCD10698133 | 131.178 | C9H9N
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 133687-93-1 | 5-(TRIFLUOROMETHYL)BENZIMIDAZOL-2(3H)-ONE | AstaTech | MFCD05663529 | 202.136 | C8H5F3N2O | 95.000 | FC(F)(F)c1ccc2[nH]c(=O)[nH]c2c1 | 1g | 532624307](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502172095.JPG-250.jpg)
eMolecules 133687-93-1 | 5-(TRIFLUOROMETHYL)BENZIMIDAZOL-2(3H)-ONE | AstaTech | MFCD05663529 | 202.136 | C8H5F3N2O | 95.000 | FC(F)(F)c1ccc2[nH]c(=O)[nH]c2c1 | 1g | 532624307
5-(TRIFLUOROMETHYL)BENZIMIDAZOL-2(3H)-ONE | AstaTech | 133687-93-1 | MFCD05663529 | 202.136 | C8H5F3N2O | 95.000 | FC(F)(F)c1ccc2[nH]c(=O)[nH]c2c1 | 1g | 532624307
Sigma Aldrich Fine Chemicals Biosciences Diacetin technical grade, 50% | Purity: 50% | Mol Wt: 176.17 | 25395-31-7 | 250ML
Diacetin technical grade, 50% | Purity: 50% | Mol Wt: 176.17 | 25395-31-7 | 250ML
Sigma Aldrich Fine Chemicals Biosciences Morin hydrate powder | 654055-01-3 | MFCD00217054 | 5G
Morin hydrate powder | 654055-01-3 | MFCD00217054 | 5G
Aobchem 2-Chloro-1-(3-iodophenyl)ethanone | 95% | CAS 20914-08-3 | C8H6ClIO | 500mg
2-Chloro-1-(3-iodophenyl)ethanone | 95% | CAS 20914-08-3 | C8H6ClIO | 500mg
Aobchem 2 3-Difluoro-N-2-propyn-1-ylbenzamide | 95% | CAS 1248176-20-6 | C10H7F2NO | 1g
2 3-Difluoro-N-2-propyn-1-ylbenzamide | 95% | CAS 1248176-20-6 | C10H7F2NO | 1g
Aobchem 1-Pentyn-3-ol 1-(3-fluorophenyl)-4-methyl- | 95% | CAS 197239-56-8 | C12H13FO | 500mg
1-Pentyn-3-ol 1-(3-fluorophenyl)-4-methyl- | 95% | CAS 197239-56-8 | C12H13FO | 500mg
Aobchem 1-Bromo-4-(1-propyn-1-yl)benzene | ≥95% | CAS 23773-30-0 | C9H7Br | 1g
1-Bromo-4-(1-propyn-1-yl)benzene | ≥95% | CAS 23773-30-0 | C9H7Br | 1g
eMolecules 33036-62-3 | 4-Bromo-1-butanol | Synthonix - Stock | MFCD00015387 | 153.019 | C4H9BrO | 80.000 | OCCCCBr | 10g | 495874611
4-Bromo-1-butanol | Synthonix - Stock | 33036-62-3 | MFCD00015387 | 153.019 | C4H9BrO | 80.000 | OCCCCBr | 10g | 495874611